C18H34O5Si — CID 10904443
methyl 2-[(3aR,4S,6R,7aS)-6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-yl]acetate (PubChem CID 10904443) has the molecular formula C18H34O5Si and a molecular weight of 358.55 g/mol. Its IUPAC name is methyl 2-[(3aR,4S,6R,7aS)-6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-yl]acetate.
| Compound Name | methyl 2-[(3aR,4S,6R,7aS)-6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-yl]acetate |
|---|---|
| PubChem CID | 10904443 |
| Molecular Formula | C18H34O5Si |
| Molecular Weight | 358.55 g/mol |
| Exact Mass | 358.22 |
| IUPAC Name | methyl 2-[(3aR,4S,6R,7aS)-6-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-4-yl]acetate |
| SMILES | COC(=O)C[C@@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C18H34O5Si/c1-17(2,3)24(7,8)23-13-9-12(10-15(19)20-6)16-14(11-13)21-18(4,5)22-16/h12-14,16H,9-11H2,1-8H3/t12-,13+,14-,16+/m0/s1 |
| InChIKey | AVZBYNJBVBWSRQ-KNCOVGOOSA-N |
| XLogP | 3.87 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.55 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|