C20H36O7Si — CID 10621849
methyl (1R,3R,7R,8R,9S)-8-[tert-butyl(dimethyl)silyl]oxy-5,5,11,11-tetramethyl-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecane-1-carboxylate (PubChem CID 10621849) has the molecular formula C20H36O7Si and a molecular weight of 416.59 g/mol. Its IUPAC name is methyl (1R,3R,7R,8R,9S)-8-[tert-butyl(dimethyl)silyl]oxy-5,5,11,11-tetramethyl-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecane-1-carboxylate.
| Compound Name | methyl (1R,3R,7R,8R,9S)-8-[tert-butyl(dimethyl)silyl]oxy-5,5,11,11-tetramethyl-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecane-1-carboxylate |
|---|---|
| PubChem CID | 10621849 |
| Molecular Formula | C20H36O7Si |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | methyl (1R,3R,7R,8R,9S)-8-[tert-butyl(dimethyl)silyl]oxy-5,5,11,11-tetramethyl-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecane-1-carboxylate |
| SMILES | COC(=O)[C@@]12C[C@H]3OC(C)(C)O[C@H]3[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(C)(C)O2 |
| InChI | InChI=1S/C20H36O7Si/c1-17(2,3)28(9,10)26-14-13-12(23-18(4,5)24-13)11-20(16(21)22-8)15(14)25-19(6,7)27-20/h12-15H,11H2,1-10H3/t12-,13-,14-,15+,20-/m1/s1 |
| InChIKey | JHKGCWDWTFDUBL-BATKGTNTSA-N |
| XLogP | 3.36 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|