C19H34O6Si — CID 102276400
(2'R,3'aS,7'R,7'aR)-7'-[tert-butyl(dimethyl)silyl]oxy-2'-methoxy-3'a-methylspiro[1,3-dioxolane-2,4'-3,5,6,7-tetrahydro-2H-1-benzofuran]-7'a-carbaldehyde (PubChem CID 102276400) has the molecular formula C19H34O6Si and a molecular weight of 386.56 g/mol. Its IUPAC name is (2'R,3'aS,7'R,7'aR)-7'-[tert-butyl(dimethyl)silyl]oxy-2'-methoxy-3'a-methylspiro[1,3-dioxolane-2,4'-3,5,6,7-tetrahydro-2H-1-benzofuran]-7'a-carbaldehyde.
| Compound Name | (2'R,3'aS,7'R,7'aR)-7'-[tert-butyl(dimethyl)silyl]oxy-2'-methoxy-3'a-methylspiro[1,3-dioxolane-2,4'-3,5,6,7-tetrahydro-2H-1-benzofuran]-7'a-carbaldehyde |
|---|---|
| PubChem CID | 102276400 |
| Molecular Formula | C19H34O6Si |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | (2'R,3'aS,7'R,7'aR)-7'-[tert-butyl(dimethyl)silyl]oxy-2'-methoxy-3'a-methylspiro[1,3-dioxolane-2,4'-3,5,6,7-tetrahydro-2H-1-benzofuran]-7'a-carbaldehyde |
| SMILES | CO[C@H]1C[C@]2(C)C3(CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@]2(C=O)O1)OCCO3 |
| InChI | InChI=1S/C19H34O6Si/c1-16(2,3)26(6,7)25-14-8-9-19(22-10-11-23-19)17(4)12-15(21-5)24-18(14,17)13-20/h13-15H,8-12H2,1-7H3/t14-,15-,17+,18+/m1/s1 |
| InChIKey | COPBKSSUBIKFEY-LMSBXDPUSA-N |
| XLogP | 3.25 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|