C19H34O6Si — CID 10834057
(1R,3R,7S,9R)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,5,11,11-tetramethyl-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecan-2-one (PubChem CID 10834057) has the molecular formula C19H34O6Si and a molecular weight of 386.56 g/mol. Its IUPAC name is (1R,3R,7S,9R)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,5,11,11-tetramethyl-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecan-2-one.
| Compound Name | (1R,3R,7S,9R)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,5,11,11-tetramethyl-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecan-2-one |
|---|---|
| PubChem CID | 10834057 |
| Molecular Formula | C19H34O6Si |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | (1R,3R,7S,9R)-7-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,5,11,11-tetramethyl-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecan-2-one |
| SMILES | CC1(C)O[C@@H]2C[C@@]3(CO[Si](C)(C)C(C)(C)C)OC(C)(C)O[C@H]3C(=O)[C@@H]2O1 |
| InChI | InChI=1S/C19H34O6Si/c1-16(2,3)26(8,9)21-11-19-10-12-14(23-17(4,5)22-12)13(20)15(19)24-18(6,7)25-19/h12,14-15H,10-11H2,1-9H3/t12-,14-,15+,19+/m1/s1 |
| InChIKey | FTPAGSLXVORDBB-IBWPGLOJSA-N |
| XLogP | 3.39 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|