C13H20O5 — CID 11832032
(3'aR,4S,7'aR)-2,2,2',2'-tetramethylspiro[1,3-dioxolane-4,6'-3a,5,7,7a-tetrahydro-1,3-benzodioxole]-4'-one (PubChem CID 11832032) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is (3'aR,4S,7'aR)-2,2,2',2'-tetramethylspiro[1,3-dioxolane-4,6'-3a,5,7,7a-tetrahydro-1,3-benzodioxole]-4'-one.
| Compound Name | (3'aR,4S,7'aR)-2,2,2',2'-tetramethylspiro[1,3-dioxolane-4,6'-3a,5,7,7a-tetrahydro-1,3-benzodioxole]-4'-one |
|---|---|
| PubChem CID | 11832032 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | (3'aR,4S,7'aR)-2,2,2',2'-tetramethylspiro[1,3-dioxolane-4,6'-3a,5,7,7a-tetrahydro-1,3-benzodioxole]-4'-one |
| SMILES | CC1(C)O[C@@H]2C[C@@]3(COC(C)(C)O3)CC(=O)[C@@H]2O1 |
| InChI | InChI=1S/C13H20O5/c1-11(2)15-7-13(18-11)5-8(14)10-9(6-13)16-12(3,4)17-10/h9-10H,5-7H2,1-4H3/t9-,10+,13-/m1/s1 |
| InChIKey | ZOTWFSKNWULAHM-GBIKHYSHSA-N |
| XLogP | 1.39 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |