About 3,3-dimethyl-2,4,8-trioxatricyclo[5.2.2.01,5]undecan-11-one
3,3-dimethyl-2,4,8-trioxatricyclo[5.2.2.01,5]undecan-11-one (PubChem CID 162418374) has the molecular formula C10H14O4
and a molecular weight of 198.22 g/mol. Its IUPAC name is 3,3-dimethyl-2,4,8-trioxatricyclo[5.2.2.01,5]undecan-11-one.
Analyze 3,3-dimethyl-2,4,8-trioxatricyclo[5.2.2.01,5]undecan-11-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyl-2,4,8-trioxatricyclo[5.2.2.01,5]undecan-11-one?
The IUPAC name of 3,3-dimethyl-2,4,8-trioxatricyclo[5.2.2.01,5]undecan-11-one (CID 162418374) is 3,3-dimethyl-2,4,8-trioxatricyclo[5.2.2.01,5]undecan-11-one.
What is the SMILES notation for 3,3-dimethyl-2,4,8-trioxatricyclo[5.2.2.01,5]undecan-11-one?
The canonical SMILES for 3,3-dimethyl-2,4,8-trioxatricyclo[5.2.2.01,5]undecan-11-one is CC1(C)OC2CC3OCC2(CC3=O)O1.
What is the InChIKey of 3,3-dimethyl-2,4,8-trioxatricyclo[5.2.2.01,5]undecan-11-one?
The InChIKey is FISMOLWVJSOXFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O4/c1-9(2)13-8-3-7-6(11)4-10(8,14-9)5-12-7/h7-8H,3-5H2,1-2H3.
What are the key properties of 3,3-dimethyl-2,4,8-trioxatricyclo[5.2.2.01,5]undecan-11-one?
3,3-dimethyl-2,4,8-trioxatricyclo[5.2.2.01,5]undecan-11-one has a molecular weight of 198.22 g/mol, XLogP of 0.64, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-2,4,8-trioxatricyclo[5.2.2.01,5]undecan-11-one is sourced from PubChem (CID 162418374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).