C15H24O7 — CID 10615310
(3'aR,4S,7'R,7'aR)-7'-(methoxymethoxy)-2,2,2',2'-tetramethylspiro[1,3-dioxolane-4,5'-3a,6,7,7a-tetrahydro-1,3-benzodioxole]-4'-one (PubChem CID 10615310) has the molecular formula C15H24O7 and a molecular weight of 316.35 g/mol. Its IUPAC name is (3'aR,4S,7'R,7'aR)-7'-(methoxymethoxy)-2,2,2',2'-tetramethylspiro[1,3-dioxolane-4,5'-3a,6,7,7a-tetrahydro-1,3-benzodioxole]-4'-one.
| Compound Name | (3'aR,4S,7'R,7'aR)-7'-(methoxymethoxy)-2,2,2',2'-tetramethylspiro[1,3-dioxolane-4,5'-3a,6,7,7a-tetrahydro-1,3-benzodioxole]-4'-one |
|---|---|
| PubChem CID | 10615310 |
| Molecular Formula | C15H24O7 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | (3'aR,4S,7'R,7'aR)-7'-(methoxymethoxy)-2,2,2',2'-tetramethylspiro[1,3-dioxolane-4,5'-3a,6,7,7a-tetrahydro-1,3-benzodioxole]-4'-one |
| SMILES | COCO[C@@H]1C[C@]2(COC(C)(C)O2)C(=O)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C15H24O7/c1-13(2)19-7-15(22-13)6-9(18-8-17-5)10-11(12(15)16)21-14(3,4)20-10/h9-11H,6-8H2,1-5H3/t9-,10-,11-,15+/m1/s1 |
| InChIKey | ISHAFTBFBDJARY-CZFOOCMKSA-N |
| XLogP | 0.99 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|