C22H40O7Si — CID 10599428
methyl (1R,3R,7R,8R,9S)-8-[tert-butyl(dimethyl)silyl]oxy-11,11-diethyl-5,5-dimethyl-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecane-1-carboxylate (PubChem CID 10599428) has the molecular formula C22H40O7Si and a molecular weight of 444.64 g/mol. Its IUPAC name is methyl (1R,3R,7R,8R,9S)-8-[tert-butyl(dimethyl)silyl]oxy-11,11-diethyl-5,5-dimethyl-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecane-1-carboxylate.
| Compound Name | methyl (1R,3R,7R,8R,9S)-8-[tert-butyl(dimethyl)silyl]oxy-11,11-diethyl-5,5-dimethyl-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecane-1-carboxylate |
|---|---|
| PubChem CID | 10599428 |
| Molecular Formula | C22H40O7Si |
| Molecular Weight | 444.64 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | methyl (1R,3R,7R,8R,9S)-8-[tert-butyl(dimethyl)silyl]oxy-11,11-diethyl-5,5-dimethyl-4,6,10,12-tetraoxatricyclo[7.3.0.03,7]dodecane-1-carboxylate |
| SMILES | CCC1(CC)O[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]3OC(C)(C)O[C@@H]3C[C@@]2(C(=O)OC)O1 |
| InChI | InChI=1S/C22H40O7Si/c1-11-21(12-2)27-17-16(28-30(9,10)19(3,4)5)15-14(25-20(6,7)26-15)13-22(17,29-21)18(23)24-8/h14-17H,11-13H2,1-10H3/t14-,15-,16-,17+,22-/m1/s1 |
| InChIKey | KCZJZZQUYJVJMN-GQTOQBHESA-N |
| XLogP | 4.14 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.64 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|