C17H30O4S2 — CID 10904550
[(4S,5S,6R)-6-[(1R)-1-(1,3-dithiolan-2-yl)butyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]methyl acetate (PubChem CID 10904550) has the molecular formula C17H30O4S2 and a molecular weight of 362.56 g/mol. Its IUPAC name is [(4S,5S,6R)-6-[(1R)-1-(1,3-dithiolan-2-yl)butyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]methyl acetate.
| Compound Name | [(4S,5S,6R)-6-[(1R)-1-(1,3-dithiolan-2-yl)butyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]methyl acetate |
|---|---|
| PubChem CID | 10904550 |
| Molecular Formula | C17H30O4S2 |
| Molecular Weight | 362.56 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | [(4S,5S,6R)-6-[(1R)-1-(1,3-dithiolan-2-yl)butyl]-2,2,5-trimethyl-1,3-dioxan-4-yl]methyl acetate |
| SMILES | CCC[C@@H](C1SCCS1)[C@@H]1OC(C)(C)O[C@H](COC(C)=O)[C@H]1C |
| InChI | InChI=1S/C17H30O4S2/c1-6-7-13(16-22-8-9-23-16)15-11(2)14(10-19-12(3)18)20-17(4,5)21-15/h11,13-16H,6-10H2,1-5H3/t11-,13-,14-,15-/m1/s1 |
| InChIKey | MCHMFKKFZOANKD-NMFUWQPSSA-N |
| XLogP | 3.93 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.56 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |