C16H30O4S2 — CID 122228341
(4S)-4-[(2S,4R)-4-(1,3-dithian-2-yl)-2-(methoxymethoxy)pentyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 122228341) has the molecular formula C16H30O4S2 and a molecular weight of 350.55 g/mol. Its IUPAC name is (4S)-4-[(2S,4R)-4-(1,3-dithian-2-yl)-2-(methoxymethoxy)pentyl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | (4S)-4-[(2S,4R)-4-(1,3-dithian-2-yl)-2-(methoxymethoxy)pentyl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 122228341 |
| Molecular Formula | C16H30O4S2 |
| Molecular Weight | 350.55 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | (4S)-4-[(2S,4R)-4-(1,3-dithian-2-yl)-2-(methoxymethoxy)pentyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | COCO[C@H](C[C@H]1COC(C)(C)O1)C[C@@H](C)C1SCCCS1 |
| InChI | InChI=1S/C16H30O4S2/c1-12(15-21-6-5-7-22-15)8-13(18-11-17-4)9-14-10-19-16(2,3)20-14/h12-15H,5-11H2,1-4H3/t12-,13+,14+/m1/s1 |
| InChIKey | FEELUVGTAURPCA-RDBSUJKOSA-N |
| XLogP | 3.74 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.55 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|