C17H32O3S3 — CID 11474487
(2R,3R,6S)-6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-3-methyl-2-[2,2,2-tris(methylsulfanyl)ethyl]oxane (PubChem CID 11474487) has the molecular formula C17H32O3S3 and a molecular weight of 380.64 g/mol. Its IUPAC name is (2R,3R,6S)-6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-3-methyl-2-[2,2,2-tris(methylsulfanyl)ethyl]oxane.
| Compound Name | (2R,3R,6S)-6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-3-methyl-2-[2,2,2-tris(methylsulfanyl)ethyl]oxane |
|---|---|
| PubChem CID | 11474487 |
| Molecular Formula | C17H32O3S3 |
| Molecular Weight | 380.64 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | (2R,3R,6S)-6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-3-methyl-2-[2,2,2-tris(methylsulfanyl)ethyl]oxane |
| SMILES | CSC(C[C@H]1O[C@H](CC2COC(C)(C)O2)CC[C@H]1C)(SC)SC |
| InChI | InChI=1S/C17H32O3S3/c1-12-7-8-13(9-14-11-18-16(2,3)20-14)19-15(12)10-17(21-4,22-5)23-6/h12-15H,7-11H2,1-6H3/t12-,13+,14?,15-/m1/s1 |
| InChIKey | PVXVVYXUVARKTE-IZGVIRRGSA-N |
| XLogP | 4.84 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.64 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|