C23H44O3S2 — CID 134937582
1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[2-(10-methylundecyl)-1,3-dithian-2-yl]ethanol (PubChem CID 134937582) has the molecular formula C23H44O3S2 and a molecular weight of 432.74 g/mol. Its IUPAC name is 1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[2-(10-methylundecyl)-1,3-dithian-2-yl]ethanol.
| Compound Name | 1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[2-(10-methylundecyl)-1,3-dithian-2-yl]ethanol |
|---|---|
| PubChem CID | 134937582 |
| Molecular Formula | C23H44O3S2 |
| Molecular Weight | 432.74 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | 1-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[2-(10-methylundecyl)-1,3-dithian-2-yl]ethanol |
| SMILES | CC(C)CCCCCCCCCC1(CC(O)[C@@H]2COC(C)(C)O2)SCCCS1 |
| InChI | InChI=1S/C23H44O3S2/c1-19(2)13-10-8-6-5-7-9-11-14-23(27-15-12-16-28-23)17-20(24)21-18-25-22(3,4)26-21/h19-21,24H,5-18H2,1-4H3/t20?,21-/m0/s1 |
| InChIKey | PWVDKLSJYBKACG-LBAQZLPGSA-N |
| XLogP | 6.62 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.74 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|