C19H38O5S — CID 101439980
(1R,2R,3R)-4-tert-butylsulfinyl-1-(2-heptyl-1,3-dioxolan-2-yl)-2-methylbutane-1,3-diol (PubChem CID 101439980) has the molecular formula C19H38O5S and a molecular weight of 378.58 g/mol. Its IUPAC name is (1R,2R,3R)-4-tert-butylsulfinyl-1-(2-heptyl-1,3-dioxolan-2-yl)-2-methylbutane-1,3-diol.
| Compound Name | (1R,2R,3R)-4-tert-butylsulfinyl-1-(2-heptyl-1,3-dioxolan-2-yl)-2-methylbutane-1,3-diol |
|---|---|
| PubChem CID | 101439980 |
| Molecular Formula | C19H38O5S |
| Molecular Weight | 378.58 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | (1R,2R,3R)-4-tert-butylsulfinyl-1-(2-heptyl-1,3-dioxolan-2-yl)-2-methylbutane-1,3-diol |
| SMILES | CCCCCCCC1([C@H](O)[C@@H](C)[C@@H](O)CS(=O)C(C)(C)C)OCCO1 |
| InChI | InChI=1S/C19H38O5S/c1-6-7-8-9-10-11-19(23-12-13-24-19)17(21)15(2)16(20)14-25(22)18(3,4)5/h15-17,20-21H,6-14H2,1-5H3/t15-,16-,17+,25?/m0/s1 |
| InChIKey | DBOJYFCXZROZAC-SSYKDEPCSA-N |
| XLogP | 3.00 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.58 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|