C22H42O5S — CID 11654644
(4S,5R,6R)-4-[[(R)-tert-butylsulfinyl]methyl]-6-(2-heptyl-1,3-dioxolan-2-yl)-2,2,5-trimethyl-1,3-dioxane (PubChem CID 11654644) has the molecular formula C22H42O5S and a molecular weight of 418.64 g/mol. Its IUPAC name is (4S,5R,6R)-4-[[(R)-tert-butylsulfinyl]methyl]-6-(2-heptyl-1,3-dioxolan-2-yl)-2,2,5-trimethyl-1,3-dioxane.
| Compound Name | (4S,5R,6R)-4-[[(R)-tert-butylsulfinyl]methyl]-6-(2-heptyl-1,3-dioxolan-2-yl)-2,2,5-trimethyl-1,3-dioxane |
|---|---|
| PubChem CID | 11654644 |
| Molecular Formula | C22H42O5S |
| Molecular Weight | 418.64 g/mol |
| Exact Mass | 418.28 |
| IUPAC Name | (4S,5R,6R)-4-[[(R)-tert-butylsulfinyl]methyl]-6-(2-heptyl-1,3-dioxolan-2-yl)-2,2,5-trimethyl-1,3-dioxane |
| SMILES | CCCCCCCC1([C@@H]2OC(C)(C)O[C@H](C[S@@](=O)C(C)(C)C)[C@@H]2C)OCCO1 |
| InChI | InChI=1S/C22H42O5S/c1-8-9-10-11-12-13-22(24-14-15-25-22)19-17(2)18(26-21(6,7)27-19)16-28(23)20(3,4)5/h17-19H,8-16H2,1-7H3/t17-,18+,19+,28+/m0/s1 |
| InChIKey | MAYHFIPHSRBRRQ-XXOMYVFHSA-N |
| XLogP | 4.79 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.64 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|