C23H26N2O2S — CID 10905315
6-heptylsulfonyl-3,4-diphenylpyridazine (PubChem CID 10905315) has the molecular formula C23H26N2O2S and a molecular weight of 394.54 g/mol. Its IUPAC name is 6-heptylsulfonyl-3,4-diphenylpyridazine.
| Compound Name | 6-heptylsulfonyl-3,4-diphenylpyridazine |
|---|---|
| PubChem CID | 10905315 |
| Molecular Formula | C23H26N2O2S |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 6-heptylsulfonyl-3,4-diphenylpyridazine |
| SMILES | CCCCCCCS(=O)(=O)c1cc(-c2ccccc2)c(-c2ccccc2)nn1 |
| InChI | InChI=1S/C23H26N2O2S/c1-2-3-4-5-12-17-28(26,27)22-18-21(19-13-8-6-9-14-19)23(25-24-22)20-15-10-7-11-16-20/h6-11,13-16,18H,2-5,12,17H2,1H3 |
| InChIKey | OXBJGGNSRIXELF-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|