About 6-heptylsulfonyl-3,4-diphenylpyridazine
6-heptylsulfonyl-3,4-diphenylpyridazine (PubChem CID 10905315) has the molecular formula C23H26N2O2S
and a molecular weight of 394.54 g/mol. Its IUPAC name is 6-heptylsulfonyl-3,4-diphenylpyridazine.
Molecular Properties
| Compound Name | 6-heptylsulfonyl-3,4-diphenylpyridazine |
| PubChem CID | 10905315 |
| Molecular Formula | C23H26N2O2S |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 6-heptylsulfonyl-3,4-diphenylpyridazine |
| SMILES | CCCCCCCS(=O)(=O)c1cc(-c2ccccc2)c(-c2ccccc2)nn1 |
| InChI | InChI=1S/C23H26N2O2S/c1-2-3-4-5-12-17-28(26,27)22-18-21(19-13-8-6-9-14-19)23(25-24-22)20-15-10-7-11-16-20/h6-11,13-16,18H,2-5,12,17H2,1H3 |
| InChIKey | OXBJGGNSRIXELF-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-heptylsulfonyl-3,4-diphenylpyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-heptylsulfonyl-3,4-diphenylpyridazine?
The IUPAC name of 6-heptylsulfonyl-3,4-diphenylpyridazine (CID 10905315) is 6-heptylsulfonyl-3,4-diphenylpyridazine.
What is the SMILES notation for 6-heptylsulfonyl-3,4-diphenylpyridazine?
The canonical SMILES for 6-heptylsulfonyl-3,4-diphenylpyridazine is CCCCCCCS(=O)(=O)c1cc(-c2ccccc2)c(-c2ccccc2)nn1.
What is the InChIKey of 6-heptylsulfonyl-3,4-diphenylpyridazine?
The InChIKey is OXBJGGNSRIXELF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26N2O2S/c1-2-3-4-5-12-17-28(26,27)22-18-21(19-13-8-6-9-14-19)23(25-24-22)20-15-10-7-11-16-20/h6-11,13-16,18H,2-5,12,17H2,1H3.
What are the key properties of 6-heptylsulfonyl-3,4-diphenylpyridazine?
6-heptylsulfonyl-3,4-diphenylpyridazine has a molecular weight of 394.54 g/mol, XLogP of 5.55, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-heptylsulfonyl-3,4-diphenylpyridazine is sourced from PubChem (CID 10905315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).