C16H26O6S3 — CID 10905690
[(2R,3R,4S)-5,5-bis(ethylsulfanyl)-2,3,4-trihydroxypentyl] 4-methylbenzenesulfonate (PubChem CID 10905690) has the molecular formula C16H26O6S3 and a molecular weight of 410.58 g/mol. Its IUPAC name is [(2R,3R,4S)-5,5-bis(ethylsulfanyl)-2,3,4-trihydroxypentyl] 4-methylbenzenesulfonate.
| Compound Name | [(2R,3R,4S)-5,5-bis(ethylsulfanyl)-2,3,4-trihydroxypentyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10905690 |
| Molecular Formula | C16H26O6S3 |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | [(2R,3R,4S)-5,5-bis(ethylsulfanyl)-2,3,4-trihydroxypentyl] 4-methylbenzenesulfonate |
| SMILES | CCSC(SCC)[C@@H](O)[C@H](O)[C@H](O)COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C16H26O6S3/c1-4-23-16(24-5-2)15(19)14(18)13(17)10-22-25(20,21)12-8-6-11(3)7-9-12/h6-9,13-19H,4-5,10H2,1-3H3/t13-,14-,15+/m1/s1 |
| InChIKey | PWFQGEVIKARDSW-KFWWJZLASA-N |
| XLogP | 1.62 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|