C21H33NO9 — CID 10906354
methyl 3-[(4R,5S)-3-acetyl-4-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-oxazolidin-5-yl]-2-oxopropanoate (PubChem CID 10906354) has the molecular formula C21H33NO9 and a molecular weight of 443.49 g/mol. Its IUPAC name is methyl 3-[(4R,5S)-3-acetyl-4-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-oxazolidin-5-yl]-2-oxopropanoate.
| Compound Name | methyl 3-[(4R,5S)-3-acetyl-4-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-oxazolidin-5-yl]-2-oxopropanoate |
|---|---|
| PubChem CID | 10906354 |
| Molecular Formula | C21H33NO9 |
| Molecular Weight | 443.49 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | methyl 3-[(4R,5S)-3-acetyl-4-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-oxazolidin-5-yl]-2-oxopropanoate |
| SMILES | COC(=O)C(=O)C[C@@H]1OC(C)(C)N(C(C)=O)[C@H]1[C@H]1OC(C)(C)O[C@@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C21H33NO9/c1-11(23)22-15(13(28-19(22,2)3)9-12(24)18(25)26-8)17-16(30-21(6,7)31-17)14-10-27-20(4,5)29-14/h13-17H,9-10H2,1-8H3/t13-,14+,15+,16+,17+/m0/s1 |
| InChIKey | KTFQSXYMHZJANG-MZBWOGCUSA-N |
| XLogP | 1.14 |
| TPSA | 109.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.49 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|