C19H24NO12+ — CID 164666395
methyl (3aR,7aR)-3-acetyl-2-oxo-4-[(1R,2R)-1,2,3-triacetyloxypropyl]-3a,4,7,7a-tetrahydropyrano[3,4-d][1,3]oxazol-5-ium-6-carboxylate (PubChem CID 164666395) has the molecular formula C19H24NO12+ and a molecular weight of 458.40 g/mol. Its IUPAC name is methyl (3aR,7aR)-3-acetyl-2-oxo-4-[(1R,2R)-1,2,3-triacetyloxypropyl]-3a,4,7,7a-tetrahydropyrano[3,4-d][1,3]oxazol-5-ium-6-carboxylate.
| Compound Name | methyl (3aR,7aR)-3-acetyl-2-oxo-4-[(1R,2R)-1,2,3-triacetyloxypropyl]-3a,4,7,7a-tetrahydropyrano[3,4-d][1,3]oxazol-5-ium-6-carboxylate |
|---|---|
| PubChem CID | 164666395 |
| Molecular Formula | C19H24NO12+ |
| Molecular Weight | 458.40 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | methyl (3aR,7aR)-3-acetyl-2-oxo-4-[(1R,2R)-1,2,3-triacetyloxypropyl]-3a,4,7,7a-tetrahydropyrano[3,4-d][1,3]oxazol-5-ium-6-carboxylate |
| SMILES | COC(=O)C1=[O+]C([C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)[C@H]2[C@@H](C1)OC(=O)N2C(C)=O |
| InChI | InChI=1S/C19H24NO12/c1-8(21)20-15-12(32-19(20)26)6-13(18(25)27-5)31-17(15)16(30-11(4)24)14(29-10(3)23)7-28-9(2)22/h12,14-17H,6-7H2,1-5H3/q+1/t12-,14-,15-,16-,17?/m1/s1 |
| InChIKey | XKOVZKAPLMFIQC-JGOAXVPOSA-N |
| XLogP | -0.80 |
| TPSA | 163.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.40 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|