C25H37NO12 — CID 10929625
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(5-octyl-2,4-dioxo-1,3-oxazolidin-3-yl)oxan-2-yl]methyl acetate (PubChem CID 10929625) has the molecular formula C25H37NO12 and a molecular weight of 543.57 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(5-octyl-2,4-dioxo-1,3-oxazolidin-3-yl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(5-octyl-2,4-dioxo-1,3-oxazolidin-3-yl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10929625 |
| Molecular Formula | C25H37NO12 |
| Molecular Weight | 543.57 g/mol |
| Exact Mass | 543.23 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(5-octyl-2,4-dioxo-1,3-oxazolidin-3-yl)oxan-2-yl]methyl acetate |
| SMILES | CCCCCCCCC1OC(=O)N([C@@H]2O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]2OC(C)=O)C1=O |
| InChI | InChI=1S/C25H37NO12/c1-6-7-8-9-10-11-12-18-23(31)26(25(32)38-18)24-22(36-17(5)30)21(35-16(4)29)20(34-15(3)28)19(37-24)13-33-14(2)27/h18-22,24H,6-13H2,1-5H3/t18?,19-,20-,21+,22-,24-/m1/s1 |
| InChIKey | CSGHXYDBRBXOEI-JPEQIOACSA-N |
| XLogP | 2.17 |
| TPSA | 161.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.57 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|