C20H33NO8 — CID 10549768
[(4R,5R)-4-[(4S,5R)-5-[(2S,3R)-3-(diethylcarbamoyl)oxiran-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxan-5-yl] acetate (PubChem CID 10549768) has the molecular formula C20H33NO8 and a molecular weight of 415.48 g/mol. Its IUPAC name is [(4R,5R)-4-[(4S,5R)-5-[(2S,3R)-3-(diethylcarbamoyl)oxiran-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxan-5-yl] acetate.
| Compound Name | [(4R,5R)-4-[(4S,5R)-5-[(2S,3R)-3-(diethylcarbamoyl)oxiran-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxan-5-yl] acetate |
|---|---|
| PubChem CID | 10549768 |
| Molecular Formula | C20H33NO8 |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | [(4R,5R)-4-[(4S,5R)-5-[(2S,3R)-3-(diethylcarbamoyl)oxiran-2-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxan-5-yl] acetate |
| SMILES | CCN(CC)C(=O)[C@@H]1O[C@H]1[C@H]1OC(C)(C)O[C@H]1[C@@H]1OC(C)(C)OC[C@H]1OC(C)=O |
| InChI | InChI=1S/C20H33NO8/c1-8-21(9-2)18(23)17-14(26-17)16-15(28-20(6,7)29-16)13-12(25-11(3)22)10-24-19(4,5)27-13/h12-17H,8-10H2,1-7H3/t12-,13-,14+,15+,16-,17-/m1/s1 |
| InChIKey | FEZFSZGEUWKZLT-KOWPAETKSA-N |
| XLogP | 1.23 |
| TPSA | 96.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|