C19H25NO12 — CID 11005017
[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)oxan-2-yl]methyl acetate (PubChem CID 11005017) has the molecular formula C19H25NO12 and a molecular weight of 459.40 g/mol. Its IUPAC name is [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11005017 |
| Molecular Formula | C19H25NO12 |
| Molecular Weight | 459.40 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | [(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](N2C(=O)OC(C)(C)C2=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C19H25NO12/c1-8(21)27-7-12-13(28-9(2)22)14(29-10(3)23)15(30-11(4)24)16(31-12)20-17(25)19(5,6)32-18(20)26/h12-16H,7H2,1-6H3/t12-,13-,14+,15-,16-/m1/s1 |
| InChIKey | XQJCNOGHQMAWSP-IBEHDNSVSA-N |
| XLogP | -0.17 |
| TPSA | 161.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.40 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|