C22H17N5O4S — CID 10906423
4-[2-[(8-hydroxyquinolin-7-yl)methylamino]-1,3-thiazol-4-yl]-3-(2-methoxyphenyl)oxadiazol-3-ium-5-olate (PubChem CID 10906423) has the molecular formula C22H17N5O4S and a molecular weight of 447.48 g/mol. Its IUPAC name is 4-[2-[(8-hydroxyquinolin-7-yl)methylamino]-1,3-thiazol-4-yl]-3-(2-methoxyphenyl)oxadiazol-3-ium-5-olate.
| Compound Name | 4-[2-[(8-hydroxyquinolin-7-yl)methylamino]-1,3-thiazol-4-yl]-3-(2-methoxyphenyl)oxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 10906423 |
| Molecular Formula | C22H17N5O4S |
| Molecular Weight | 447.48 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | 4-[2-[(8-hydroxyquinolin-7-yl)methylamino]-1,3-thiazol-4-yl]-3-(2-methoxyphenyl)oxadiazol-3-ium-5-olate |
| SMILES | COc1ccccc1-[n+]1noc([O-])c1-c1csc(NCc2ccc3cccnc3c2O)n1 |
| InChI | InChI=1S/C22H17N5O4S/c1-30-17-7-3-2-6-16(17)27-19(21(29)31-26-27)15-12-32-22(25-15)24-11-14-9-8-13-5-4-10-23-18(13)20(14)28/h2-10,12H,11H2,1H3,(H2-,24,25,26,28,29) |
| InChIKey | OPRLYCPQNSXZKJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.48 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|