C22H18N5O4S+ — CID 10917306
4-[2-[(8-hydroxyquinolin-7-yl)methylamino]-1,3-thiazol-4-yl]-3-(4-methoxyphenyl)-2H-oxadiazol-3-ium-5-one (PubChem CID 10917306) has the molecular formula C22H18N5O4S+ and a molecular weight of 448.48 g/mol. Its IUPAC name is 4-[2-[(8-hydroxyquinolin-7-yl)methylamino]-1,3-thiazol-4-yl]-3-(4-methoxyphenyl)-2H-oxadiazol-3-ium-5-one.
| Compound Name | 4-[2-[(8-hydroxyquinolin-7-yl)methylamino]-1,3-thiazol-4-yl]-3-(4-methoxyphenyl)-2H-oxadiazol-3-ium-5-one |
|---|---|
| PubChem CID | 10917306 |
| Molecular Formula | C22H18N5O4S+ |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | 4-[2-[(8-hydroxyquinolin-7-yl)methylamino]-1,3-thiazol-4-yl]-3-(4-methoxyphenyl)-2H-oxadiazol-3-ium-5-one |
| SMILES | COc1ccc(-[n+]2[nH]oc(=O)c2-c2csc(NCc3ccc4cccnc4c3O)n2)cc1 |
| InChI | InChI=1S/C22H17N5O4S/c1-30-16-8-6-15(7-9-16)27-19(21(29)31-26-27)17-12-32-22(25-17)24-11-14-5-4-13-3-2-10-23-18(13)20(14)28/h2-10,12H,11H2,1H3,(H2-,24,25,26,28,29)/p+1 |
| InChIKey | DRNCAZWVQBNJBJ-UHFFFAOYSA-O |
| XLogP | 3.24 |
| TPSA | 117.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|