C23H19N5O3S — CID 11091547
3-(2,5-dimethylphenyl)-4-[2-[(8-hydroxyquinolin-7-yl)methylamino]-1,3-thiazol-4-yl]oxadiazol-3-ium-5-olate (PubChem CID 11091547) has the molecular formula C23H19N5O3S and a molecular weight of 445.50 g/mol. Its IUPAC name is 3-(2,5-dimethylphenyl)-4-[2-[(8-hydroxyquinolin-7-yl)methylamino]-1,3-thiazol-4-yl]oxadiazol-3-ium-5-olate.
| Compound Name | 3-(2,5-dimethylphenyl)-4-[2-[(8-hydroxyquinolin-7-yl)methylamino]-1,3-thiazol-4-yl]oxadiazol-3-ium-5-olate |
|---|---|
| PubChem CID | 11091547 |
| Molecular Formula | C23H19N5O3S |
| Molecular Weight | 445.50 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | 3-(2,5-dimethylphenyl)-4-[2-[(8-hydroxyquinolin-7-yl)methylamino]-1,3-thiazol-4-yl]oxadiazol-3-ium-5-olate |
| SMILES | Cc1ccc(C)c(-[n+]2noc([O-])c2-c2csc(NCc3ccc4cccnc4c3O)n2)c1 |
| InChI | InChI=1S/C23H19N5O3S/c1-13-5-6-14(2)18(10-13)28-20(22(30)31-27-28)17-12-32-23(26-17)25-11-16-8-7-15-4-3-9-24-19(15)21(16)29/h3-10,12H,11H2,1-2H3,(H2-,25,26,27,29,30) |
| InChIKey | GNTZJUCHJMEYGD-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.50 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|