C16H18N2O4 — CID 154770124
oxolan-2-ylmethyl N-[(8-hydroxyquinolin-7-yl)methyl]carbamate (PubChem CID 154770124) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is oxolan-2-ylmethyl N-[(8-hydroxyquinolin-7-yl)methyl]carbamate.
| Compound Name | oxolan-2-ylmethyl N-[(8-hydroxyquinolin-7-yl)methyl]carbamate |
|---|---|
| PubChem CID | 154770124 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | oxolan-2-ylmethyl N-[(8-hydroxyquinolin-7-yl)methyl]carbamate |
| SMILES | O=C(NCc1ccc2cccnc2c1O)OCC1CCCO1 |
| InChI | InChI=1S/C16H18N2O4/c19-15-12(6-5-11-3-1-7-17-14(11)15)9-18-16(20)22-10-13-4-2-8-21-13/h1,3,5-7,13,19H,2,4,8-10H2,(H,18,20) |
| InChIKey | OHYSRWLXSKTXIJ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|