C16H20N4O4 — CID 109068979
N-(2-methoxyethyl)-1-(morpholine-4-carbonyl)imidazo[1,5-a]pyridine-3-carboxamide (PubChem CID 109068979) has the molecular formula C16H20N4O4 and a molecular weight of 332.36 g/mol. Its IUPAC name is N-(2-methoxyethyl)-1-(morpholine-4-carbonyl)imidazo[1,5-a]pyridine-3-carboxamide.
| Compound Name | N-(2-methoxyethyl)-1-(morpholine-4-carbonyl)imidazo[1,5-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109068979 |
| Molecular Formula | C16H20N4O4 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | N-(2-methoxyethyl)-1-(morpholine-4-carbonyl)imidazo[1,5-a]pyridine-3-carboxamide |
| SMILES | COCCNC(=O)c1nc(C(=O)N2CCOCC2)c2ccccn12 |
| InChI | InChI=1S/C16H20N4O4/c1-23-9-5-17-15(21)14-18-13(12-4-2-3-6-20(12)14)16(22)19-7-10-24-11-8-19/h2-4,6H,5,7-11H2,1H3,(H,17,21) |
| InChIKey | RDUSZAHCDDQVBI-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|