C31H52N2O5 — CID 10907565
methyl 2-[decyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]benzoyl]amino]octanoate (PubChem CID 10907565) has the molecular formula C31H52N2O5 and a molecular weight of 532.77 g/mol. Its IUPAC name is methyl 2-[decyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]benzoyl]amino]octanoate.
| Compound Name | methyl 2-[decyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]benzoyl]amino]octanoate |
|---|---|
| PubChem CID | 10907565 |
| Molecular Formula | C31H52N2O5 |
| Molecular Weight | 532.77 g/mol |
| Exact Mass | 532.39 |
| IUPAC Name | methyl 2-[decyl-[2-[(2-methylpropan-2-yl)oxycarbonylamino]benzoyl]amino]octanoate |
| SMILES | CCCCCCCCCCN(C(=O)c1ccccc1NC(=O)OC(C)(C)C)C(CCCCCC)C(=O)OC |
| InChI | InChI=1S/C31H52N2O5/c1-7-9-11-13-14-15-16-20-24-33(27(29(35)37-6)23-17-12-10-8-2)28(34)25-21-18-19-22-26(25)32-30(36)38-31(3,4)5/h18-19,21-22,27H,7-17,20,23-24H2,1-6H3,(H,32,36) |
| InChIKey | YTDHBJGOUCCIGJ-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.77 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|