C21H23N5O3 — CID 109076255
3-N-(5-methyl-1,2-oxazol-3-yl)-1-N-[(3-methylphenyl)methyl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide (PubChem CID 109076255) has the molecular formula C21H23N5O3 and a molecular weight of 393.45 g/mol. Its IUPAC name is 3-N-(5-methyl-1,2-oxazol-3-yl)-1-N-[(3-methylphenyl)methyl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide.
| Compound Name | 3-N-(5-methyl-1,2-oxazol-3-yl)-1-N-[(3-methylphenyl)methyl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109076255 |
| Molecular Formula | C21H23N5O3 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 3-N-(5-methyl-1,2-oxazol-3-yl)-1-N-[(3-methylphenyl)methyl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide |
| SMILES | Cc1cccc(CNC(=O)c2nc(C(=O)Nc3cc(C)on3)n3c2CCCC3)c1 |
| InChI | InChI=1S/C21H23N5O3/c1-13-6-5-7-15(10-13)12-22-20(27)18-16-8-3-4-9-26(16)19(24-18)21(28)23-17-11-14(2)29-25-17/h5-7,10-11H,3-4,8-9,12H2,1-2H3,(H,22,27)(H,23,25,28) |
| InChIKey | JTHUNRKZXYJYBO-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 102.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |