C19H20N6O3 — CID 109076526
1-N-(5-methyl-1,2-oxazol-3-yl)-3-N-(pyridin-4-ylmethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide (PubChem CID 109076526) has the molecular formula C19H20N6O3 and a molecular weight of 380.41 g/mol. Its IUPAC name is 1-N-(5-methyl-1,2-oxazol-3-yl)-3-N-(pyridin-4-ylmethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide.
| Compound Name | 1-N-(5-methyl-1,2-oxazol-3-yl)-3-N-(pyridin-4-ylmethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109076526 |
| Molecular Formula | C19H20N6O3 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 1-N-(5-methyl-1,2-oxazol-3-yl)-3-N-(pyridin-4-ylmethyl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide |
| SMILES | Cc1cc(NC(=O)c2nc(C(=O)NCc3ccncc3)n3c2CCCC3)no1 |
| InChI | InChI=1S/C19H20N6O3/c1-12-10-15(24-28-12)22-18(26)16-14-4-2-3-9-25(14)17(23-16)19(27)21-11-13-5-7-20-8-6-13/h5-8,10H,2-4,9,11H2,1H3,(H,21,27)(H,22,24,26) |
| InChIKey | WURGTGGKGQRMBV-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 114.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |