C20H20FN5O3 — CID 109076334
1-N-[(2-fluorophenyl)methyl]-3-N-(5-methyl-1,2-oxazol-3-yl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide (PubChem CID 109076334) has the molecular formula C20H20FN5O3 and a molecular weight of 397.41 g/mol. Its IUPAC name is 1-N-[(2-fluorophenyl)methyl]-3-N-(5-methyl-1,2-oxazol-3-yl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide.
| Compound Name | 1-N-[(2-fluorophenyl)methyl]-3-N-(5-methyl-1,2-oxazol-3-yl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109076334 |
| Molecular Formula | C20H20FN5O3 |
| Molecular Weight | 397.41 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 1-N-[(2-fluorophenyl)methyl]-3-N-(5-methyl-1,2-oxazol-3-yl)-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-1,3-dicarboxamide |
| SMILES | Cc1cc(NC(=O)c2nc(C(=O)NCc3ccccc3F)c3n2CCCC3)no1 |
| InChI | InChI=1S/C20H20FN5O3/c1-12-10-16(25-29-12)23-20(28)18-24-17(15-8-4-5-9-26(15)18)19(27)22-11-13-6-2-3-7-14(13)21/h2-3,6-7,10H,4-5,8-9,11H2,1H3,(H,22,27)(H,23,25,28) |
| InChIKey | FSGGZJRETQZSCC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 102.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.41 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |