C19H22ClN3O2 — CID 109080015
4-N-butan-2-yl-2-N-[2-(3-chlorophenyl)ethyl]pyridine-2,4-dicarboxamide (PubChem CID 109080015) has the molecular formula C19H22ClN3O2 and a molecular weight of 359.86 g/mol. Its IUPAC name is 4-N-butan-2-yl-2-N-[2-(3-chlorophenyl)ethyl]pyridine-2,4-dicarboxamide.
| Compound Name | 4-N-butan-2-yl-2-N-[2-(3-chlorophenyl)ethyl]pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109080015 |
| Molecular Formula | C19H22ClN3O2 |
| Molecular Weight | 359.86 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 4-N-butan-2-yl-2-N-[2-(3-chlorophenyl)ethyl]pyridine-2,4-dicarboxamide |
| SMILES | CCC(C)NC(=O)c1ccnc(C(=O)NCCc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C19H22ClN3O2/c1-3-13(2)23-18(24)15-8-10-21-17(12-15)19(25)22-9-7-14-5-4-6-16(20)11-14/h4-6,8,10-13H,3,7,9H2,1-2H3,(H,22,25)(H,23,24) |
| InChIKey | MFEKYWOSHLVSMH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.86 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |