C19H22ClN3O2 — CID 109088785
2-N-[2-(3-chlorophenyl)ethyl]-4-N,4-N-diethylpyridine-2,4-dicarboxamide (PubChem CID 109088785) has the molecular formula C19H22ClN3O2 and a molecular weight of 359.86 g/mol. Its IUPAC name is 2-N-[2-(3-chlorophenyl)ethyl]-4-N,4-N-diethylpyridine-2,4-dicarboxamide.
| Compound Name | 2-N-[2-(3-chlorophenyl)ethyl]-4-N,4-N-diethylpyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109088785 |
| Molecular Formula | C19H22ClN3O2 |
| Molecular Weight | 359.86 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 2-N-[2-(3-chlorophenyl)ethyl]-4-N,4-N-diethylpyridine-2,4-dicarboxamide |
| SMILES | CCN(CC)C(=O)c1ccnc(C(=O)NCCc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C19H22ClN3O2/c1-3-23(4-2)19(25)15-9-11-21-17(13-15)18(24)22-10-8-14-6-5-7-16(20)12-14/h5-7,9,11-13H,3-4,8,10H2,1-2H3,(H,22,24) |
| InChIKey | GIRHDTDQWRGCAC-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.86 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |