C19H21Cl2N3O2 — CID 109088909
4-N-[2-(2,4-dichlorophenyl)ethyl]-2-N,2-N-diethylpyridine-2,4-dicarboxamide (PubChem CID 109088909) has the molecular formula C19H21Cl2N3O2 and a molecular weight of 394.30 g/mol. Its IUPAC name is 4-N-[2-(2,4-dichlorophenyl)ethyl]-2-N,2-N-diethylpyridine-2,4-dicarboxamide.
| Compound Name | 4-N-[2-(2,4-dichlorophenyl)ethyl]-2-N,2-N-diethylpyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109088909 |
| Molecular Formula | C19H21Cl2N3O2 |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 4-N-[2-(2,4-dichlorophenyl)ethyl]-2-N,2-N-diethylpyridine-2,4-dicarboxamide |
| SMILES | CCN(CC)C(=O)c1cc(C(=O)NCCc2ccc(Cl)cc2Cl)ccn1 |
| InChI | InChI=1S/C19H21Cl2N3O2/c1-3-24(4-2)19(26)17-11-14(8-9-22-17)18(25)23-10-7-13-5-6-15(20)12-16(13)21/h5-6,8-9,11-12H,3-4,7,10H2,1-2H3,(H,23,25) |
| InChIKey | CBTBVRDRCQNMDH-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |