C24H25N3O2 — CID 109080088
2-N-benzyl-4-N-butan-2-yl-2-N-phenylpyridine-2,4-dicarboxamide (PubChem CID 109080088) has the molecular formula C24H25N3O2 and a molecular weight of 387.48 g/mol. Its IUPAC name is 2-N-benzyl-4-N-butan-2-yl-2-N-phenylpyridine-2,4-dicarboxamide.
| Compound Name | 2-N-benzyl-4-N-butan-2-yl-2-N-phenylpyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109080088 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 2-N-benzyl-4-N-butan-2-yl-2-N-phenylpyridine-2,4-dicarboxamide |
| SMILES | CCC(C)NC(=O)c1ccnc(C(=O)N(Cc2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C24H25N3O2/c1-3-18(2)26-23(28)20-14-15-25-22(16-20)24(29)27(21-12-8-5-9-13-21)17-19-10-6-4-7-11-19/h4-16,18H,3,17H2,1-2H3,(H,26,28) |
| InChIKey | RNTCCUYOYSAJSU-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |