C39H46O5 — CID 10908097
(E,2S,5R)-5-[(4-methoxyphenyl)methoxymethoxy]-3,4-dimethyl-2-(3-trityloxypropyl)hex-3-en-1-ol (PubChem CID 10908097) has the molecular formula C39H46O5 and a molecular weight of 594.79 g/mol. Its IUPAC name is (E,2S,5R)-5-[(4-methoxyphenyl)methoxymethoxy]-3,4-dimethyl-2-(3-trityloxypropyl)hex-3-en-1-ol.
| Compound Name | (E,2S,5R)-5-[(4-methoxyphenyl)methoxymethoxy]-3,4-dimethyl-2-(3-trityloxypropyl)hex-3-en-1-ol |
|---|---|
| PubChem CID | 10908097 |
| Molecular Formula | C39H46O5 |
| Molecular Weight | 594.79 g/mol |
| Exact Mass | 594.33 |
| IUPAC Name | (E,2S,5R)-5-[(4-methoxyphenyl)methoxymethoxy]-3,4-dimethyl-2-(3-trityloxypropyl)hex-3-en-1-ol |
| SMILES | COc1ccc(COCO[C@H](C)/C(C)=C(\C)[C@@H](CO)CCCOC(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C39H46O5/c1-30(32(3)43-29-42-28-33-22-24-38(41-4)25-23-33)31(2)34(27-40)15-14-26-44-39(35-16-8-5-9-17-35,36-18-10-6-11-19-36)37-20-12-7-13-21-37/h5-13,16-25,32,34,40H,14-15,26-29H2,1-4H3/b31-30+/t32-,34-/m1/s1 |
| InChIKey | OJWNCTIKQKFBOB-IDIKYWQXSA-N |
| XLogP | 8.31 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.79 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|