C18H27N3O3 — CID 109083306
2-N-(oxolan-2-ylmethyl)-4-N,4-N-dipropylpyridine-2,4-dicarboxamide (PubChem CID 109083306) has the molecular formula C18H27N3O3 and a molecular weight of 333.43 g/mol. Its IUPAC name is 2-N-(oxolan-2-ylmethyl)-4-N,4-N-dipropylpyridine-2,4-dicarboxamide.
| Compound Name | 2-N-(oxolan-2-ylmethyl)-4-N,4-N-dipropylpyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109083306 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | 2-N-(oxolan-2-ylmethyl)-4-N,4-N-dipropylpyridine-2,4-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1ccnc(C(=O)NCC2CCCO2)c1 |
| InChI | InChI=1S/C18H27N3O3/c1-3-9-21(10-4-2)18(23)14-7-8-19-16(12-14)17(22)20-13-15-6-5-11-24-15/h7-8,12,15H,3-6,9-11,13H2,1-2H3,(H,20,22) |
| InChIKey | CMGULNZJCKXZQI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |