C31H30O2P2 — CID 10909079
[(1R,3R,5R,6S)-3-diphenylphosphanyloxy-6-bicyclo[3.2.0]heptanyl]oxy-diphenylphosphane (PubChem CID 10909079) has the molecular formula C31H30O2P2 and a molecular weight of 496.53 g/mol. Its IUPAC name is [(1R,3R,5R,6S)-3-diphenylphosphanyloxy-6-bicyclo[3.2.0]heptanyl]oxy-diphenylphosphane.
| Compound Name | [(1R,3R,5R,6S)-3-diphenylphosphanyloxy-6-bicyclo[3.2.0]heptanyl]oxy-diphenylphosphane |
|---|---|
| PubChem CID | 10909079 |
| Molecular Formula | C31H30O2P2 |
| Molecular Weight | 496.53 g/mol |
| Exact Mass | 496.17 |
| IUPAC Name | [(1R,3R,5R,6S)-3-diphenylphosphanyloxy-6-bicyclo[3.2.0]heptanyl]oxy-diphenylphosphane |
| SMILES | c1ccc(P(O[C@@H]2C[C@@H]3C[C@H](OP(c4ccccc4)c4ccccc4)[C@@H]3C2)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H30O2P2/c1-5-13-26(14-6-1)34(27-15-7-2-8-16-27)32-25-21-24-22-31(30(24)23-25)33-35(28-17-9-3-10-18-28)29-19-11-4-12-20-29/h1-20,24-25,30-31H,21-23H2/t24-,25-,30-,31+/m1/s1 |
| InChIKey | AGGJIVJTNNJKSV-ISYCQBLMSA-N |
| XLogP | 6.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.53 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|