C20H28N4O4 — CID 109095151
ethyl 4-[[6-(piperidine-1-carbonyl)pyridine-2-carbonyl]amino]piperidine-1-carboxylate (PubChem CID 109095151) has the molecular formula C20H28N4O4 and a molecular weight of 388.47 g/mol. Its IUPAC name is ethyl 4-[[6-(piperidine-1-carbonyl)pyridine-2-carbonyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[6-(piperidine-1-carbonyl)pyridine-2-carbonyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 109095151 |
| Molecular Formula | C20H28N4O4 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | ethyl 4-[[6-(piperidine-1-carbonyl)pyridine-2-carbonyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)c2cccc(C(=O)N3CCCCC3)n2)CC1 |
| InChI | InChI=1S/C20H28N4O4/c1-2-28-20(27)24-13-9-15(10-14-24)21-18(25)16-7-6-8-17(22-16)19(26)23-11-4-3-5-12-23/h6-8,15H,2-5,9-14H2,1H3,(H,21,25) |
| InChIKey | QPHUPKTXNQMGPB-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |