C20H20N4O5 — CID 109096981
methyl 2-[[6-(4-formylpiperazine-1-carbonyl)pyridine-2-carbonyl]amino]benzoate (PubChem CID 109096981) has the molecular formula C20H20N4O5 and a molecular weight of 396.40 g/mol. Its IUPAC name is methyl 2-[[6-(4-formylpiperazine-1-carbonyl)pyridine-2-carbonyl]amino]benzoate.
| Compound Name | methyl 2-[[6-(4-formylpiperazine-1-carbonyl)pyridine-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 109096981 |
| Molecular Formula | C20H20N4O5 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | methyl 2-[[6-(4-formylpiperazine-1-carbonyl)pyridine-2-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)c1cccc(C(=O)N2CCN(C=O)CC2)n1 |
| InChI | InChI=1S/C20H20N4O5/c1-29-20(28)14-5-2-3-6-15(14)22-18(26)16-7-4-8-17(21-16)19(27)24-11-9-23(13-25)10-12-24/h2-8,13H,9-12H2,1H3,(H,22,26) |
| InChIKey | CHMIBLILNMTDRJ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 108.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|