C18H20N4O4S — CID 109101769
5-N-prop-2-enyl-3-N-[2-(4-sulfamoylphenyl)ethyl]pyridine-3,5-dicarboxamide (PubChem CID 109101769) has the molecular formula C18H20N4O4S and a molecular weight of 388.45 g/mol. Its IUPAC name is 5-N-prop-2-enyl-3-N-[2-(4-sulfamoylphenyl)ethyl]pyridine-3,5-dicarboxamide.
| Compound Name | 5-N-prop-2-enyl-3-N-[2-(4-sulfamoylphenyl)ethyl]pyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109101769 |
| Molecular Formula | C18H20N4O4S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 5-N-prop-2-enyl-3-N-[2-(4-sulfamoylphenyl)ethyl]pyridine-3,5-dicarboxamide |
| SMILES | C=CCNC(=O)c1cncc(C(=O)NCCc2ccc(S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C18H20N4O4S/c1-2-8-21-17(23)14-10-15(12-20-11-14)18(24)22-9-7-13-3-5-16(6-4-13)27(19,25)26/h2-6,10-12H,1,7-9H2,(H,21,23)(H,22,24)(H2,19,25,26) |
| InChIKey | OWDILMQKBUGVBM-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 131.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|