C18H26N4O3 — CID 109102673
5-N-cyclopentyl-3-N-(2-morpholin-4-ylethyl)pyridine-3,5-dicarboxamide (PubChem CID 109102673) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is 5-N-cyclopentyl-3-N-(2-morpholin-4-ylethyl)pyridine-3,5-dicarboxamide.
| Compound Name | 5-N-cyclopentyl-3-N-(2-morpholin-4-ylethyl)pyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109102673 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 5-N-cyclopentyl-3-N-(2-morpholin-4-ylethyl)pyridine-3,5-dicarboxamide |
| SMILES | O=C(NCCN1CCOCC1)c1cncc(C(=O)NC2CCCC2)c1 |
| InChI | InChI=1S/C18H26N4O3/c23-17(20-5-6-22-7-9-25-10-8-22)14-11-15(13-19-12-14)18(24)21-16-3-1-2-4-16/h11-13,16H,1-10H2,(H,20,23)(H,21,24) |
| InChIKey | JUZOIFUYHKNPCX-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |