C19H20N4O2 — CID 109107206
5-N-(3-cyanophenyl)-3-N-(3-methylbutyl)pyridine-3,5-dicarboxamide (PubChem CID 109107206) has the molecular formula C19H20N4O2 and a molecular weight of 336.40 g/mol. Its IUPAC name is 5-N-(3-cyanophenyl)-3-N-(3-methylbutyl)pyridine-3,5-dicarboxamide.
| Compound Name | 5-N-(3-cyanophenyl)-3-N-(3-methylbutyl)pyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109107206 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 5-N-(3-cyanophenyl)-3-N-(3-methylbutyl)pyridine-3,5-dicarboxamide |
| SMILES | CC(C)CCNC(=O)c1cncc(C(=O)Nc2cccc(C#N)c2)c1 |
| InChI | InChI=1S/C19H20N4O2/c1-13(2)6-7-22-18(24)15-9-16(12-21-11-15)19(25)23-17-5-3-4-14(8-17)10-20/h3-5,8-9,11-13H,6-7H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | STBSXCZYAYBHAF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |