C22H18N4O2 — CID 109108491
3-N-(3-cyanophenyl)-5-N-(2-ethylphenyl)pyridine-3,5-dicarboxamide (PubChem CID 109108491) has the molecular formula C22H18N4O2 and a molecular weight of 370.41 g/mol. Its IUPAC name is 3-N-(3-cyanophenyl)-5-N-(2-ethylphenyl)pyridine-3,5-dicarboxamide.
| Compound Name | 3-N-(3-cyanophenyl)-5-N-(2-ethylphenyl)pyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109108491 |
| Molecular Formula | C22H18N4O2 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 3-N-(3-cyanophenyl)-5-N-(2-ethylphenyl)pyridine-3,5-dicarboxamide |
| SMILES | CCc1ccccc1NC(=O)c1cncc(C(=O)Nc2cccc(C#N)c2)c1 |
| InChI | InChI=1S/C22H18N4O2/c1-2-16-7-3-4-9-20(16)26-22(28)18-11-17(13-24-14-18)21(27)25-19-8-5-6-15(10-19)12-23/h3-11,13-14H,2H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | DNXQEBWSUNDTCP-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |