C17H18N4O — CID 109225107
N-(3-cyanophenyl)-5-(2-methylpropylamino)pyridine-3-carboxamide (PubChem CID 109225107) has the molecular formula C17H18N4O and a molecular weight of 294.36 g/mol. Its IUPAC name is N-(3-cyanophenyl)-5-(2-methylpropylamino)pyridine-3-carboxamide.
| Compound Name | N-(3-cyanophenyl)-5-(2-methylpropylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109225107 |
| Molecular Formula | C17H18N4O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | N-(3-cyanophenyl)-5-(2-methylpropylamino)pyridine-3-carboxamide |
| SMILES | CC(C)CNc1cncc(C(=O)Nc2cccc(C#N)c2)c1 |
| InChI | InChI=1S/C17H18N4O/c1-12(2)9-20-16-7-14(10-19-11-16)17(22)21-15-5-3-4-13(6-15)8-18/h3-7,10-12,20H,9H2,1-2H3,(H,21,22) |
| InChIKey | GSVFBEBCAZHCKN-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |