C13H19NO2 — CID 10911108
(3R,4aS,8aR)-3-methyl-1-propan-2-yl-4a,5,6,8a-tetrahydroquinoline-2,4-dione (PubChem CID 10911108) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is (3R,4aS,8aR)-3-methyl-1-propan-2-yl-4a,5,6,8a-tetrahydroquinoline-2,4-dione.
| Compound Name | (3R,4aS,8aR)-3-methyl-1-propan-2-yl-4a,5,6,8a-tetrahydroquinoline-2,4-dione |
|---|---|
| PubChem CID | 10911108 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | (3R,4aS,8aR)-3-methyl-1-propan-2-yl-4a,5,6,8a-tetrahydroquinoline-2,4-dione |
| SMILES | CC(C)N1C(=O)[C@H](C)C(=O)[C@H]2CCC=C[C@H]21 |
| InChI | InChI=1S/C13H19NO2/c1-8(2)14-11-7-5-4-6-10(11)12(15)9(3)13(14)16/h5,7-11H,4,6H2,1-3H3/t9-,10+,11-/m1/s1 |
| InChIKey | VVSFSJPBEKBHLF-OUAUKWLOSA-N |
| XLogP | 1.78 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|