About 2-hydroxy-2-oxoacetate;hydroxy-[(1S)-1-phenylethyl]azanium
2-hydroxy-2-oxoacetate;hydroxy-[(1S)-1-phenylethyl]azanium (PubChem CID 10911280) has the molecular formula C10H13NO5
and a molecular weight of 227.22 g/mol. Its IUPAC name is 2-hydroxy-2-oxoacetate;hydroxy-[(1S)-1-phenylethyl]azanium.
Molecular Properties
| Compound Name | 2-hydroxy-2-oxoacetate;hydroxy-[(1S)-1-phenylethyl]azanium |
| PubChem CID | 10911280 |
| Molecular Formula | C10H13NO5 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 2-hydroxy-2-oxoacetate;hydroxy-[(1S)-1-phenylethyl]azanium |
| SMILES | C[C@H]([NH2+]O)c1ccccc1.O=C([O-])C(=O)O |
| InChI | InChI=1S/C8H11NO.C2H2O4/c1-7(9-10)8-5-3-2-4-6-8;3-1(4)2(5)6/h2-7,9-10H,1H3;(H,3,4)(H,5,6)/t7-;/m0./s1 |
| InChIKey | GUXMGLCOBSBIKH-FJXQXJEOSA-N |
| XLogP | -1.48 |
| TPSA | 114.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-2-oxoacetate;hydroxy-[(1S)-1-phenylethyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-2-oxoacetate;hydroxy-[(1S)-1-phenylethyl]azanium?
The IUPAC name of 2-hydroxy-2-oxoacetate;hydroxy-[(1S)-1-phenylethyl]azanium (CID 10911280) is 2-hydroxy-2-oxoacetate;hydroxy-[(1S)-1-phenylethyl]azanium.
What is the SMILES notation for 2-hydroxy-2-oxoacetate;hydroxy-[(1S)-1-phenylethyl]azanium?
The canonical SMILES for 2-hydroxy-2-oxoacetate;hydroxy-[(1S)-1-phenylethyl]azanium is C[C@H]([NH2+]O)c1ccccc1.O=C([O-])C(=O)O.
What is the InChIKey of 2-hydroxy-2-oxoacetate;hydroxy-[(1S)-1-phenylethyl]azanium?
The InChIKey is GUXMGLCOBSBIKH-FJXQXJEOSA-N. The full InChI is InChI=1S/C8H11NO.C2H2O4/c1-7(9-10)8-5-3-2-4-6-8;3-1(4)2(5)6/h2-7,9-10H,1H3;(H,3,4)(H,5,6)/t7-;/m0./s1.
What are the key properties of 2-hydroxy-2-oxoacetate;hydroxy-[(1S)-1-phenylethyl]azanium?
2-hydroxy-2-oxoacetate;hydroxy-[(1S)-1-phenylethyl]azanium has a molecular weight of 227.22 g/mol, XLogP of -1.48, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-2-oxoacetate;hydroxy-[(1S)-1-phenylethyl]azanium is sourced from PubChem (CID 10911280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).