C15H23NO4 — CID 10912965
4-O-tert-butyl 1-O-prop-2-enyl (2S)-2-methyl-3,6-dihydro-2H-pyridine-1,4-dicarboxylate (PubChem CID 10912965) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-prop-2-enyl (2S)-2-methyl-3,6-dihydro-2H-pyridine-1,4-dicarboxylate.
| Compound Name | 4-O-tert-butyl 1-O-prop-2-enyl (2S)-2-methyl-3,6-dihydro-2H-pyridine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 10912965 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 4-O-tert-butyl 1-O-prop-2-enyl (2S)-2-methyl-3,6-dihydro-2H-pyridine-1,4-dicarboxylate |
| SMILES | C=CCOC(=O)N1CC=C(C(=O)OC(C)(C)C)C[C@@H]1C |
| InChI | InChI=1S/C15H23NO4/c1-6-9-19-14(18)16-8-7-12(10-11(16)2)13(17)20-15(3,4)5/h6-7,11H,1,8-10H2,2-5H3/t11-/m0/s1 |
| InChIKey | CZNPCNUEWFKLAS-NSHDSACASA-N |
| XLogP | 2.67 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|