C17H29NO5 — CID 135014077
tert-butyl (5S)-2-ethoxy-5-[(E)-3-ethoxy-2-methyl-3-oxoprop-1-enyl]pyrrolidine-1-carboxylate (PubChem CID 135014077) has the molecular formula C17H29NO5 and a molecular weight of 327.42 g/mol. Its IUPAC name is tert-butyl (5S)-2-ethoxy-5-[(E)-3-ethoxy-2-methyl-3-oxoprop-1-enyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (5S)-2-ethoxy-5-[(E)-3-ethoxy-2-methyl-3-oxoprop-1-enyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 135014077 |
| Molecular Formula | C17H29NO5 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | tert-butyl (5S)-2-ethoxy-5-[(E)-3-ethoxy-2-methyl-3-oxoprop-1-enyl]pyrrolidine-1-carboxylate |
| SMILES | CCOC(=O)/C(C)=C/[C@@H]1CCC(OCC)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H29NO5/c1-7-21-14-10-9-13(11-12(3)15(19)22-8-2)18(14)16(20)23-17(4,5)6/h11,13-14H,7-10H2,1-6H3/b12-11+/t13-,14?/m0/s1 |
| InChIKey | IWIZXJPHEPCWJY-CVBYYZAHSA-N |
| XLogP | 3.26 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|