C16H30O2Si — CID 10913007
(3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyloct-1-en-7-yn-3-ol (PubChem CID 10913007) has the molecular formula C16H30O2Si and a molecular weight of 282.50 g/mol. Its IUPAC name is (3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyloct-1-en-7-yn-3-ol.
| Compound Name | (3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyloct-1-en-7-yn-3-ol |
|---|---|
| PubChem CID | 10913007 |
| Molecular Formula | C16H30O2Si |
| Molecular Weight | 282.50 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | (3R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4,4-dimethyloct-1-en-7-yn-3-ol |
| SMILES | C#CC[C@@H](O[Si](C)(C)C(C)(C)C)C(C)(C)[C@H](O)C=C |
| InChI | InChI=1S/C16H30O2Si/c1-10-12-14(16(6,7)13(17)11-2)18-19(8,9)15(3,4)5/h1,11,13-14,17H,2,12H2,3-9H3/t13-,14-/m1/s1 |
| InChIKey | SVMFVHCMFBVLMM-ZIAGYGMSSA-N |
| XLogP | 3.97 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|