C15H25Br — CID 10913092
2-[(E)-5-bromo-3-methylpent-3-enyl]-1,3,3-trimethylcyclohexene (PubChem CID 10913092) has the molecular formula C15H25Br and a molecular weight of 285.27 g/mol. Its IUPAC name is 2-[(E)-5-bromo-3-methylpent-3-enyl]-1,3,3-trimethylcyclohexene.
| Compound Name | 2-[(E)-5-bromo-3-methylpent-3-enyl]-1,3,3-trimethylcyclohexene |
|---|---|
| PubChem CID | 10913092 |
| Molecular Formula | C15H25Br |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 2-[(E)-5-bromo-3-methylpent-3-enyl]-1,3,3-trimethylcyclohexene |
| SMILES | CC1=C(CC/C(C)=C/CBr)C(C)(C)CCC1 |
| InChI | InChI=1S/C15H25Br/c1-12(9-11-16)7-8-14-13(2)6-5-10-15(14,3)4/h9H,5-8,10-11H2,1-4H3/b12-9+ |
| InChIKey | ULXPZTJJLNUQDV-FMIVXFBMSA-N |
| XLogP | 5.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|